CAS 37964-17-3

1H-Pyrrole-3-carboxylic acid, ethyl ester

Description:

1H-Pyrrole-3-carboxylic acid, ethyl ester, with the CAS number 37964-17-3, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ethyl ester enhances its lipophilicity, making it more soluble in organic solvents compared to its acid counterpart. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in synthesizing pharmaceuticals and agrochemicals. Its reactivity can be attributed to the electrophilic nature of the pyrrole nitrogen and the carboxylic acid group, allowing for various chemical transformations. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₇H₉NO₂

InChI: InChI=1S/C7H9NO2/c1-2-10-7(9)6-3-4-8-5-6/h3-5,8H,2H2,1H3

InChI key: InChIKey=ICJYWDHNTMJKFP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=CNC1

Synonyms:

• 3-Carbethoxypyrrole
• Ethyl pyrrole-3-carboxylate
• ethyl 1H-pyrrole-3-carboxylate

1H-PYRROLE-3-CARBOXYLIC ACID ETHYL ESTER

CAS: 37964-17-3

Formula: C₇H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.1519

Ref: IN-DA00BXQM

Ethyl 1H-pyrrole-3-carboxylate

CAS: 37964-17-3

Ethyl 1H-pyrrole-3-carboxylate

Purity: 99%

Molecular weight: 139.154g/mol

Ref: 54-OR74576

Ethyl 1H-pyrrole-3-carboxylate

CAS: 37964-17-3

Formula: C₇H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.154

Ref: 10-F233520

Ethyl 1H-pyrrole-3-carboxylate

CAS: 37964-17-3

Ethyl 1H-pyrrole-3-carboxylate is a nitro compound that has been shown to be efficient and multisubstituted. It reacts with carbon monoxide to form a nitro group, which can then be reduced by reductive means. Ethyl 1H-pyrrole-3-carboxylate is also capable of forming vinyl or carbonyl compounds in the presence of appropriate reagents.

Formula: C₇H₉NO₂

Purity: Min. 95%

Molecular weight: 139.15 g/mol

Ref: 3D-MBA96417