CymitQuimica logo

CAS 37968-97-1

:

4,4-Dipyridyl sulfide

Description:
4,4-Dipyridyl sulfide, with the CAS number 37968-97-1, is an organic compound characterized by its structure, which features two pyridine rings connected by a sulfur atom. This compound typically appears as a solid and is known for its potential applications in coordination chemistry and as a ligand in metal complexes. It exhibits properties such as solubility in organic solvents, which makes it useful in various chemical reactions and syntheses. The presence of the pyridine rings contributes to its aromatic character, influencing its reactivity and interaction with other chemical species. Additionally, 4,4-Dipyridyl sulfide may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can vary depending on the conditions, such as temperature and the presence of other reagents. Overall, 4,4-Dipyridyl sulfide is a versatile compound with significant implications in both industrial and research settings.
Formula:C10H8N2S
InChI:InChI=1/C10H8N2S/c1-5-11-6-2-9(1)13-10-3-7-12-8-4-10/h1-8H
InChI key:XGJOFCCBFCHEHK-UHFFFAOYSA-N
SMILES:c1cnccc1Sc1ccncc1
Synonyms:
  • 4,4'-Sulfanediyldipyridine
  • Dipyridylsulfide
Found 6 products.