CAS 379725-42-5

4-Chloro-3-[[(4-iodophenyl)amino]sulfonyl]benzoic acid

Description:

4-Chloro-3-[[(4-iodophenyl)amino]sulfonyl]benzoic acid, with the CAS number 379725-42-5, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chloro group and a sulfonamide linkage to an iodophenyl group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, including potential solubility in polar solvents and moderate stability under standard conditions. The presence of the chloro and iodo substituents can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the sulfonamide group may impart biological activity, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies. As with many chemical substances, handling should be conducted with care, considering safety data and potential hazards associated with its components.

Formula: C₁₃H₉ClINO₄S

InChI: InChI=1S/C13H9ClINO4S/c14-11-6-1-8(13(17)18)7-12(11)21(19,20)16-10-4-2-9(15)3-5-10/h1-7,16H,(H,17,18)

InChI key: InChIKey=GSCDBKDBOKSHFU-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(I)C=C1)(=O)(=O)C2=CC(C(O)=O)=CC=C2Cl

Synonyms:

• 4-Chloro-3-[[(4-iodophenyl)amino]sulfonyl]benzoic acid
• Benzoic acid, 4-chloro-3-[[(4-iodophenyl)amino]sulfonyl]-

4-Chloro-3-[(4-iodophenyl)sulfamoyl]benzoic acid

CAS: 379725-42-5

Versatile small molecule scaffold

Formula: C₁₃H₉ClINO₄S

Purity: Min. 95%

Molecular weight: 437.64 g/mol

Ref: 3D-EQA72542