CAS 379726-52-0

3-[(Ethylphenylamino)sulfonyl]-4-methylbenzoic acid

Description:

3-[(Ethylphenylamino)sulfonyl]-4-methylbenzoic acid, identified by its CAS number 379726-52-0, is a chemical compound characterized by its sulfonamide functional group, which contributes to its potential biological activity. This compound features a benzoic acid moiety, indicating it has both acidic and aromatic properties. The presence of the ethylphenylamino group suggests that it may exhibit significant interactions with biological targets, potentially influencing its solubility and reactivity. The methyl group on the benzoic acid ring can affect the steric and electronic properties of the molecule, potentially enhancing its pharmacological profile. As a sulfonamide, it may also exhibit antibacterial properties, although specific biological activities would depend on further empirical studies. The compound's structure suggests it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its stability, solubility, and reactivity would be influenced by the functional groups present, making it a candidate for various applications in pharmaceutical research.

Formula: C₁₆H₁₇NO₄S

InChI: InChI=1S/C16H17NO4S/c1-3-17(14-7-5-4-6-8-14)22(20,21)15-11-13(16(18)19)10-9-12(15)2/h4-11H,3H2,1-2H3,(H,18,19)

InChI key: InChIKey=BWSIREDWHPPKSD-UHFFFAOYSA-N

SMILES: S(N(CC)C1=CC=CC=C1)(=O)(=O)C2=CC(C(O)=O)=CC=C2C

Synonyms:

• Benzoic acid, 3-[(ethylphenylamino)sulfonyl]-4-methyl-
• 3-[(Ethylphenylamino)sulfonyl]-4-methylbenzoic acid

3-[Ethyl(phenyl)sulfamoyl]-4-methylbenzoic acid

CAS: 379726-52-0

Versatile small molecule scaffold

Formula: C₁₆H₁₇NO₄S

Purity: Min. 95%

Molecular weight: 319.4 g/mol

Ref: 3D-EQA72652