CAS 379729-49-4

4-[[4-(Diethylamino)phenyl]methylene]-1,2,3,4-tetrahydro-9-acridinecarboxylic acid

Description:

4-[[4-(Diethylamino)phenyl]methylene]-1,2,3,4-tetrahydro-9-acridinecarboxylic acid, identified by its CAS number 379729-49-4, is a synthetic organic compound characterized by its complex structure, which includes an acridine core and a diethylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and dyes. The presence of the diethylamino group suggests that it may possess basic properties, which can influence its solubility and reactivity. Additionally, the tetrahydro structure indicates that it may have a degree of saturation, affecting its stability and interaction with biological systems. The carboxylic acid functional group can participate in hydrogen bonding and may play a role in the compound's biological activity. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest for further research and potential applications in medicinal chemistry.

Formula: C₂₅H₂₆N₂O₂

InChI: InChI=1S/C25H26N2O2/c1-3-27(4-2)19-14-12-17(13-15-19)16-18-8-7-10-21-23(25(28)29)20-9-5-6-11-22(20)26-24(18)21/h5-6,9,11-16H,3-4,7-8,10H2,1-2H3,(H,28,29)

InChI key: InChIKey=QUWAQVNHTYTWFP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(=CC3=CC=C(N(CC)CC)C=C3)CCC2)=NC=4C1=CC=CC4

Synonyms:

• 4-[[4-(Diethylamino)phenyl]methylene]-1,2,3,4-tetrahydro-9-acridinecarboxylic acid
• 9-Acridinecarboxylic acid, 4-[[4-(diethylamino)phenyl]methylene]-1,2,3,4-tetrahydro-

4-{[4-(diethylamino)phenyl]methylidene}-1,2,3,4-tetrahydroacridine-9-carboxylic acid

CAS: 379729-49-4

Purity: 95%

Molecular weight: 386.495

Ref: 10-F985974