CAS 37979-67-2
:benzyl 3-({amino[bis(2-chloroethyl)amino]phosphoryl}oxy)propanoate
Description:
Benzyl 3-({amino[bis(2-chloroethyl)amino]phosphoryl}oxy)propanoate, identified by CAS number 37979-67-2, is a chemical compound that features a complex structure incorporating a benzyl group, a propanoate moiety, and a phosphoryl group linked to an amino group. This compound is characterized by its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to drug development or therapeutic applications. The presence of the bis(2-chloroethyl)amino group suggests potential reactivity and interactions typical of alkylating agents, which can be significant in the context of cancer treatment. Additionally, the phosphoryl group may impart unique chemical properties, influencing solubility and reactivity. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest a multifaceted role in chemical and biological systems, warranting further investigation into its applications and effects.
Formula:C14H21Cl2N2O4P
InChI:InChI=1/C14H21Cl2N2O4P/c15-7-9-18(10-8-16)23(17,20)22-11-6-14(19)21-12-13-4-2-1-3-5-13/h1-5H,6-12H2,(H2,17,20)
SMILES:c1ccc(cc1)COC(=O)CCOP(=O)(N)N(CCCl)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Carboxyphosphamide Benzyl Ester
CAS:Controlled ProductApplications Intermediate in the production of Cyclophosphamide metabolites.
References Takamizawa, A., et al.: Chem. Pharm. Bull., 20, 1612 (1972),Formula:C14H21Cl2N2O4PColor and Shape:NeatMolecular weight:383.21
