CAS 37988-18-4: N1,N3,N5-Tris(2-hydroxyethyl)-1,3,5-benzenetricarboxamide
Description:N1,N3,N5-Tris(2-hydroxyethyl)-1,3,5-benzenetricarboxamide, with the CAS number 37988-18-4, is a synthetic organic compound characterized by its structure, which features a benzene ring with three carboxamide groups and three hydroxyethyl substituents. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of hydroxyl groups that enhance its hydrophilicity. It exhibits properties such as good thermal stability and potential biocompatibility, making it of interest in various applications, including pharmaceuticals and materials science. The presence of multiple functional groups allows for potential interactions in biological systems, which may lead to applications in drug delivery or as a stabilizing agent in formulations. Additionally, its ability to form hydrogen bonds can influence its solubility and reactivity, making it a versatile compound in chemical synthesis and formulation chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C15H21N3O6
InChI:InChI=1S/C15H21N3O6/c19-4-1-16-13(22)10-7-11(14(23)17-2-5-20)9-12(8-10)15(24)18-3-6-21/h7-9,19-21H,1-6H2,(H,16,22)(H,17,23)(H,18,24)
InChI key:InChIKey=RGWJKANXFYJKHN-UHFFFAOYSA-N
SMILES:O=C(NCCO)C=1C=C(C=C(C1)C(=O)NCCO)C(=O)NCCO
- Synonyms:
- N1,N3,N5-Tris(2-hydroxyethyl)-1,3,5-benzenetricarboxamide
- LM 22A4
- N,N′,N′′-Tris(β-hydroxyethyl)trimesamide
- 1,3,5-Benzenetricarboxamide, N,N′,N′′-tris(2-hydroxyethyl)-
- 1,3,5-Benzenetricarboxamide, N1,N3,N5-tris(2-hydroxyethyl)-
