CymitQuimica logo

CAS 3800-15-5

:

1-(4-fluorophenyl)-4-(morpholin-4-yl)butan-1-one

Description:
1-(4-Fluorophenyl)-4-(morpholin-4-yl)butan-1-one, with the CAS number 3800-15-5, is a chemical compound that belongs to the class of substituted ketones. It features a butanone backbone with a 4-fluorophenyl group and a morpholine moiety, which contributes to its unique properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. Morpholine, a cyclic amine, adds to the compound's potential for interaction with biological targets, making it of interest in medicinal chemistry. The compound is typically characterized by its molecular structure, which includes a ketone functional group, and its physical properties such as solubility, melting point, and boiling point, which can vary based on the specific conditions. Its applications may extend to pharmaceuticals or agrochemicals, depending on its biological activity and efficacy. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C14H18FNO2
InChI:InChI=1/C14H18FNO2/c15-13-5-3-12(4-6-13)14(17)2-1-7-16-8-10-18-11-9-16/h3-6H,1-2,7-11H2
SMILES:C(CC(=O)c1ccc(cc1)F)CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.