CAS 38007-83-9

N-{4-[(4-bromophenyl)sulfanyl]phenyl}-2-chloroacetamide

Description:

N-{4-[(4-bromophenyl)sulfanyl]phenyl}-2-chloroacetamide, with the CAS number 38007-83-9, is an organic compound characterized by its complex structure, which includes a chloroacetamide functional group and a sulfanyl group attached to a phenyl ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloro group, which can participate in nucleophilic substitution reactions. The bromophenyl moiety contributes to its hydrophobic characteristics and may influence its biological activity. The presence of sulfur in the sulfanyl group can also impart unique chemical reactivity and stability. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development or as a building block in organic synthesis. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values.

Formula: C₁₄H₁₁BrClNOS

InChI: InChI=1/C14H11BrClNOS/c15-10-1-5-12(6-2-10)19-13-7-3-11(4-8-13)17-14(18)9-16/h1-8H,9H2,(H,17,18)

Synonyms:

• N-{4-[(4-bromophenyl)thio]phenyl}-2-chloroacetamide

N-{4-[(4-Bromophenyl)sulfanyl]phenyl}-2-chloroacetamide

CAS: 38007-83-9

Versatile small molecule scaffold

Formula: C₁₄H₁₁BrClNOS

Purity: Min. 95%

Molecular weight: 356.7 g/mol

Ref: 3D-NBA00783