CAS 38008-37-6

2-chloro-N-[4-(4-ethoxyphenoxy)phenyl]acetamide

Description:

2-Chloro-N-[4-(4-ethoxyphenoxy)phenyl]acetamide, with the CAS number 38008-37-6, is an organic compound characterized by its complex molecular structure, which includes a chloro group, an acetamide functional group, and an ethoxyphenoxy moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The chloro substituent can influence its reactivity and biological activity, potentially enhancing its lipophilicity. The ethoxyphenoxy group may contribute to its overall stability and solubility profile, making it suitable for various applications in medicinal chemistry and material science. Additionally, the presence of aromatic rings suggests potential for π-π stacking interactions, which can be relevant in biological systems or when considering the compound's behavior in different environments. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in drug development or chemical synthesis contexts.

Formula: C₁₆H₁₆ClNO₃

InChI: InChI=1/C16H16ClNO3/c1-2-20-13-7-9-15(10-8-13)21-14-5-3-12(4-6-14)18-16(19)11-17/h3-10H,2,11H2,1H3,(H,18,19)

SMILES: CCOc1ccc(cc1)Oc1ccc(cc1)NC(=O)CCl

Synonyms:

• 2-Chlor-N-[4-(4-ethoxyphenoxy)phenyl]acetamid
• acetamide, 2-chloro-N-[4-(4-ethoxyphenoxy)phenyl]-

2-Chloro-N-[4-(4-ethoxyphenoxy)phenyl]acetamide

CAS: 38008-37-6

Versatile small molecule scaffold

Formula: C₁₆H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 305.75 g/mol

Ref: 3D-NBA00837