CymitQuimica logo

CAS 380151-86-0

:

3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde

Description:
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde is an organic compound characterized by the presence of a benzaldehyde functional group and a dioxaborolane moiety. The compound features a benzene ring substituted with a dioxaborolane, which is a five-membered cyclic compound containing boron and oxygen. This structure imparts unique reactivity, particularly in cross-coupling reactions, making it valuable in synthetic organic chemistry. The presence of the tetramethyl groups enhances the stability of the dioxaborolane, reducing the likelihood of hydrolysis and increasing its utility in various chemical transformations. The compound is typically used as an intermediate in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Its properties include moderate solubility in organic solvents and potential reactivity with nucleophiles due to the electrophilic nature of the aldehyde group. Overall, this compound exemplifies the intersection of boron chemistry and organic synthesis, showcasing the versatility of boron-containing compounds in modern chemical applications.
Formula:C13H17BO3
InChI:InChI=1/C13H17BO3/c1-12(2)13(3,4)17-14(16-12)11-7-5-6-10(8-11)9-15/h5-9H,1-4H3
InChI key:IFYMOLFMYIDYEN-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cccc(c2)C=O)O1
Synonyms:
  • Benzaldehyde, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Found 6 products.