CAS 380221-63-6

1-Deoxy-1-[6-[(2,2-diphenylethyl)amino]-2-[[[2-[[[[1-(2-pyridinyl)-4-piperidinyl]amino]carbonyl]amino]ethyl]amino]carbonyl]-9H-purin-9-yl]-N-ethyl-β-D-ribofuranuronamide

Description:

1-Deoxy-1-[6-[(2,2-diphenylethyl)amino]-2-[[[2-[[[[1-(2-pyridinyl)-4-piperidinyl]amino]carbonyl]amino]ethyl]amino]carbonyl]-9H-purin-9-yl]-N-ethyl-β-D-ribofuranuronamide, identified by CAS number 380221-63-6, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amines, carbonyls, and a purine base. This compound is likely to exhibit significant biological activity due to its structural features, which may interact with various biological targets. Its ribofuranuronamide moiety suggests potential applications in biochemistry or medicinal chemistry, possibly as a nucleoside analog or in the development of therapeutic agents. The presence of a diphenylethyl group may enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the compound's synthesis and stability would be of interest in research contexts, particularly in drug development. Overall, this substance represents a class of compounds that could be explored for their potential therapeutic effects, although specific biological activities and mechanisms would require further investigation.

Formula: C₄₀H₄₇N₁₁O₆

InChI: InChI=1S/C40H47N11O6/c1-2-41-37(54)33-31(52)32(53)39(57-33)51-24-46-30-34(45-23-28(25-11-5-3-6-12-25)26-13-7-4-8-14-26)48-35(49-36(30)51)38(55)43-19-20-44-40(56)47-27-16-21-50(22-17-27)29-15-9-10-18-42-29/h3-15,18,24,27-28,31-33,39,52-53H,2,16-17,19-23H2,1H3,(H,41,54)(H,43,55)(H2,44,47,56)(H,45,48,49)/t31-,32+,33-,39+/m0/s1

InChI key: InChIKey=ZOTHAEBAWXWVID-HXEFRTELSA-N

SMILES: N(CC(C1=CC=CC=C1)C2=CC=CC=C2)C3=C4C(N(C=N4)[C@@H]5O[C@H](C(NCC)=O)[C@@H](O)[C@H]5O)=NC(C(NCCNC(NC6CCN(CC6)C7=CC=CC=N7)=O)=O)=N3

Synonyms:

• A 1193
• UK 432097
• Axon 1193
• 1-Deoxy-1-[6-[(2,2-diphenylethyl)amino]-2-[[[2-[[[[1-(2-pyridinyl)-4-piperidinyl]amino]carbonyl]amino]ethyl]amino]carbonyl]-9H-purin-9-yl]-N-ethyl-β-D-ribofuranuronamide
• β-D-Ribofuranuronamide, 1-deoxy-1-[6-[(2,2-diphenylethyl)amino]-2-[[[2-[[[[1-(2-pyridinyl)-4-piperidinyl]amino]carbonyl]amino]ethyl]amino]carbonyl]-9H-purin-9-yl]-N-ethyl-

UK 432097

CAS: 380221-63-6

UK 432097 is an experimental pharmaceutical compound, specifically, a selective agonist for the A2A adenosine receptor, which is synthesized through chemical means. Its mode of action involves the binding and activation of the A2A adenosine receptor, leading to a cascade of intracellular signaling pathways that result in the suppression of inflammatory responses. This mechanism reflects the drug's ability to modulate immune cell activity and reduce inflammation.

Formula: C₄₀H₄₇N₁₁O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 777.9 g/mol

Ref: 3D-FQA22163

UK-432097

CAS: 380221-63-6

UK 432097 is an adenosine A2A agonist.

Formula: C₄₀H₄₇N₁₁O₆

Color and Shape: Solid

Molecular weight: 777.87

Ref: TM-T29049