CymitQuimica logo

CAS 380230-02-4

:

(S)-(+)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a;3,4-a']dinaphthalen-4-yl)bis[(1S)-1-phenylethyl]amine

Description:
The chemical substance known as (S)-(+)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a;3,4-a']dinaphthalen-4-yl)bis[(1S)-1-phenylethyl]amine, with CAS number 380230-02-4, is a complex organic compound characterized by its unique structural features, including a phosphorous atom integrated into a bicyclic framework. This compound contains multiple functional groups, including amine and ether functionalities, which contribute to its reactivity and potential applications in various fields such as medicinal chemistry and materials science. The presence of chiral centers in the molecule indicates that it can exist in different stereoisomeric forms, which may influence its biological activity and interactions. Additionally, the compound's intricate structure suggests potential for use in catalysis or as a ligand in coordination chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature, making it a subject of interest for further research in synthetic and applied chemistry.
Formula:C36H30NO2P
InChI:InChI=1/C36H30NO2P/c1-25(27-13-5-3-6-14-27)37(26(2)28-15-7-4-8-16-28)40-38-33-23-21-29-17-9-11-19-31(29)35(33)36-32-20-12-10-18-30(32)22-24-34(36)39-40/h3-26H,1-2H3/t25-,26-/m0/s1
InChI key:LKZPDRCMCSBQFN-UIOOFZCWSA-N
SMILES:C[C@@H](c1ccccc1)N([C@@H](C)c1ccccc1)p1oc2ccc3ccccc3c2c2c3ccccc3ccc2o1
Synonyms:
  • (S,S,S)-(+)-(3,5-Dioxa-4-phosphacyclohepta[2,1-a:3,4-a']dinaphthalen-4-yl)bis(1-phenylethyl)amine
  • (+)-N,N-Bis[(1S)-1-phenylethyl]-dinaphtho[2,1-D:1',2'-F][1,3,2]dioxaphosphepin-4-amine, (11br)
  • N,N-bis[(1S)-1-phenylethyl]dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine
  • (S)-(+)-(3,5-dioxa-4-heteropoly-cycloheptane[2,1-a
  • 3,4-a']dinaphthalene4-yl) double[(1S)-1-phenyl ethyl]amine
Found 5 products.