CAS 38025-52-4

2-[benzyl(methyl)amino]ethanethiol

Description:

2-[Benzyl(methyl)amino]ethanethiol, with the CAS number 38025-52-4, is an organic compound characterized by the presence of a thiol functional group (-SH) attached to an ethane backbone. This compound features a benzyl group and a methyl group attached to a nitrogen atom, indicating it is a substituted amine. The presence of the thiol group imparts unique properties, such as the ability to form disulfide bonds and participate in redox reactions, making it relevant in various chemical and biological contexts. The compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (benzyl) and hydrophilic (thiol) components, influencing its solubility in different solvents. Additionally, the amine functionality can engage in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, 2-[benzyl(methyl)amino]ethanethiol is a versatile compound with potential applications in pharmaceuticals, biochemistry, and materials science, particularly in the synthesis of more complex molecules or as a reagent in organic reactions.

Formula: C₁₀H₁₅NS

InChI: InChI=1/C10H15NS/c1-11(7-8-12)9-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3

SMILES: CN(CCS)Cc1ccccc1

2-[Benzyl(methyl)amino]ethane-1-thiol

CAS: 38025-52-4

Versatile small molecule scaffold

Formula: C₁₀H₁₅NS

Purity: Min. 95%

Molecular weight: 181.3 g/mol

Ref: 3D-NBA02552