CAS 380349-02-0

4-Chloro-3-[[[2-(4-morpholinyl)phenyl]amino]sulfonyl]benzoic acid

Description:

4-Chloro-3-[[[2-(4-morpholinyl)phenyl]amino]sulfonyl]benzoic acid, with the CAS number 380349-02-0, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a sulfonamide group and a morpholine-containing phenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the context of medicinal chemistry. The presence of the chloro and sulfonyl groups may contribute to its reactivity and interaction with biological targets. Additionally, the morpholine ring can enhance its pharmacokinetic properties, making it a candidate for further investigation in drug design. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a significant interest in the field of drug discovery and development.

Formula: C₁₇H₁₇ClN₂O₅S

InChI: InChI=1S/C17H17ClN2O5S/c18-13-6-5-12(17(21)22)11-16(13)26(23,24)19-14-3-1-2-4-15(14)20-7-9-25-10-8-20/h1-6,11,19H,7-10H2,(H,21,22)

InChI key: InChIKey=YLPZYQLDYVCOSH-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC(C(O)=O)=CC=C1Cl)C2=C(C=CC=C2)N3CCOCC3

Synonyms:

• Benzoic acid, 4-chloro-3-[[[2-(4-morpholinyl)phenyl]amino]sulfonyl]-
• 4-Chloro-3-[[[2-(4-morpholinyl)phenyl]amino]sulfonyl]benzoic acid

4-Chloro-3-{[2-(morpholin-4-yl)phenyl]sulfamoyl}benzoic acid

CAS: 380349-02-0

Versatile small molecule scaffold

Formula: C₁₇H₁₇ClN₂O₅S

Purity: Min. 95%

Molecular weight: 396.8 g/mol

Ref: 3D-FQA34902