CAS 3804-16-8
:2-(7-chloro-1H-indol-3-yl)ethanamine
Description:
2-(7-chloro-1H-indol-3-yl)ethanamine, with the CAS number 3804-16-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a chloro substituent at the 7-position of the indole ring and an ethanamine side chain, which contributes to its amine functional group. The presence of the chlorine atom can influence the compound's reactivity and biological activity, potentially affecting its interaction with various biological targets. Typically, compounds of this nature may exhibit properties such as being soluble in organic solvents and having moderate to low solubility in water, depending on the specific functional groups present. Additionally, due to its structural characteristics, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography.
Formula:C10H11ClN2
InChI:InChI=1/C10H11ClN2/c11-9-3-1-2-8-7(4-5-12)6-13-10(8)9/h1-3,6,13H,4-5,12H2
SMILES:c1cc2c(CCN)c[nH]c2c(c1)Cl
Synonyms:- 1H-Indole-3-ethanamine, 7-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(7-Chloro-1H-indol-3-yl)ethan-1-amine
CAS:Controlled Product7-Chloro-1,2,3,4-tetrahydroisoquinoline alkaloids are indole alkaloids that have been found in a wide variety of plants. They are synthesized through oxidative coupling and chlorination of tryptamine. The chlorination step is catalyzed by an enzyme called 7-chloroindole synthase (ICS). This enzyme is encoded by a gene that has been cloned from the plant cell line N6. A number of compounds related to 7-chloroindole have been found in soil bacteria. These compounds can be used for the construction of synthetic pathways for the production of different heterocycles. One such compound is 2-(7-chloro-1H-indol-3-yl)ethanamine, which has shown receptor activity against serotonin.
Formula:C10H11ClN2Purity:Min. 95%Molecular weight:194.66 g/mol
