CAS 3804-23-7: Acetic acid, scandium(3+) salt (3:1)
Description:Acetic acid, scandium(3+) salt (3:1), with the CAS number 3804-23-7, is a coordination compound formed from scandium ions and acetic acid. This substance typically appears as a white crystalline solid and is soluble in water, reflecting the polar nature of both its components. The scandium ion, being a trivalent metal, can form stable complexes with acetic acid, which acts as a bidentate ligand, coordinating through its carboxylate groups. This compound is of interest in various fields, including materials science and catalysis, due to the unique properties imparted by the scandium ion, such as its ability to influence the electronic and structural characteristics of the resulting complex. Additionally, scandium compounds are known for their potential applications in advanced ceramics and as catalysts in organic reactions. Safety data indicates that, like many metal salts, it should be handled with care to avoid ingestion or inhalation, and appropriate safety measures should be taken during its use in laboratory or industrial settings.
Formula:C2H4O2Sc
InChI:InChI=1S/C2H4O2.Sc/c1-2(3)4;/h1H3,(H,3,4);
InChI key:InChIKey=OQRMRSDZEJMEHR-UHFFFAOYSA-N
SMILES:[Sc].O=C(O)C
- Synonyms:
- Acetic acid, scandium(3+) salt
- Acetic acid, scandium(3+) salt (3:1)
- Scandium acetate
- Scandium acetate (Sc(OAc)<sub>3</sub>)
- Scandium triacetate
- Scandium(III) acetate
- Scandium acetate (Sc(OAc)3)
- Scandium(3+) acetate
Scandium(III) acetate hydrate (99.9%-Sc) (REO)
Ref: 08-93-2101
| 1g | 102.00 € | ||
| 5g | 379.00 € |
Scandium(III) Acetate Hydrate
Ref: 3B-S0534
| 1g | 74.00 € |
Ref: 7W-GX4514
| 1g | 351.00 € | ||
| 5g | 899.00 € |
Ref: 7W-GX1407
| 1g | 248.00 € | ||
| 5g | 612.00 € |
Scandium acetate hydrate
Ref: 3D-DAA80423
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
