CAS 380427-40-7

7-Cyanooxindole

Description:

7-Cyanooxindole is a chemical compound characterized by its oxindole structure, which features a bicyclic framework consisting of a benzene ring fused to a five-membered lactam. The presence of a cyano group (-CN) at the 7-position enhances its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and is known for its role in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. 7-Cyanooxindole can participate in various chemical transformations, including nucleophilic additions and cycloadditions, making it a versatile intermediate in organic synthesis. Its unique structure allows for interactions with biological targets, which has led to research into its potential as an anti-cancer agent and in other therapeutic areas. Additionally, its solubility and stability in different solvents can vary, influencing its practical applications in laboratory settings. Overall, 7-Cyanooxindole is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₉H₆N₂O

InChI: InChI=1/C9H6N2O/c10-5-7-3-1-2-6-4-8(12)11-9(6)7/h1-3H,4H2,(H,11,12)

SMILES: c1cc2CC(=Nc2c(c1)C#N)O

Synonyms:

• 2-oxo-2,3-dihydro-1H-indole-7-carbonitrile

7-CYANOOXINDOLE

CAS: 380427-40-7

Formula: C₉H₆N₂O

Purity: 97%

Molecular weight: 158.1567

Ref: IN-DA00BYXO

7-Cyanooxindole

CAS: 380427-40-7

7-Cyanooxindole

Purity: ≥95%

Molecular weight: 158.16g/mol

Ref: 54-OR10428

2-Oxoindoline-7-carbonitrile

CAS: 380427-40-7

Formula: C₉H₆N₂O

Purity: 98%

Molecular weight: 158.16

Ref: 10-F321227