CAS 380430-49-9
:(4-BOC-aminophenyl)boronic acid
Description:
(4-BOC-aminophenyl)boronic acid is an organic compound characterized by the presence of both a boronic acid functional group and a tert-butyloxycarbonyl (BOC) protecting group attached to an amino group on a phenyl ring. The BOC group serves as a protective moiety for the amine, facilitating various synthetic applications, particularly in peptide synthesis and medicinal chemistry. The boronic acid functionality allows for the formation of covalent bonds with diols, making it useful in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. This compound typically exhibits moderate solubility in polar organic solvents and may display acidic properties due to the boronic acid group. Its reactivity and functional versatility make it valuable in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the BOC group can influence the compound's stability and reactivity, making it an important consideration in synthetic pathways. Overall, (4-BOC-aminophenyl)boronic acid is a significant building block in organic synthesis and medicinal chemistry.
Formula:C11H16BNO4
InChI:InChI=1/C11H16BNO4/c1-11(2,3)17-10(14)13-9-6-4-8(5-7-9)12(15)16/h4-7,15-16H,1-3H3,(H,13,14)
SMILES:CC(C)(C)OC(=O)Nc1ccc(cc1)B(O)O
Synonyms:- [4-(t-Butoxycarbonylamino)phenyl]boronic acid
- {4-[(Tert-Butoxycarbonyl)Amino]Phenyl}Boronic Acid
- 4-(tert-Butoxycarbonyl)aminophenylboronicacid
- 4-(N-Boc-amino)phenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-[(tert-Butoxycarbonyl)amino]phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C11H16BNO4Purity:97.0 to 109.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:237.064-(Boc-amino)benzeneboronic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H16BNO4Purity:97%Color and Shape:White to cream, PowderMolecular weight:237.06[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid
CAS:Formula:C11H16BNO4Purity:98%Color and Shape:SolidMolecular weight:237.06004-Aminobenzeneboronic acid, N-BOC protected
CAS:4-Aminobenzeneboronic acid, N-BOC protectedFormula:C11H16BNO4Purity:98%Color and Shape: white to off-white solidMolecular weight:237.06g/mol4-(N-Tert-Butoxycarbonyl)aminophenylboronic acid
CAS:Formula:C11H16BNO4Purity:98%Color and Shape:SolidMolecular weight:237.06





