CymitQuimica logo

CAS 380430-76-2

:

1,1,1-Trifluoro-4-[(2-fluorophenyl)amino]-3-buten-2-one

Description:
1,1,1-Trifluoro-4-[(2-fluorophenyl)amino]-3-buten-2-one is a synthetic organic compound characterized by its unique trifluoromethyl and fluorophenyl functional groups. This compound features a butenone backbone, which contributes to its reactivity and potential applications in various chemical reactions. The presence of multiple fluorine atoms enhances its lipophilicity and stability, making it of interest in medicinal chemistry and agrochemical research. The compound's structure suggests it may exhibit interesting biological activity, potentially acting as a pharmaceutical agent or a precursor in the synthesis of more complex molecules. Its CAS number, 380430-76-2, allows for easy identification in chemical databases. As with many fluorinated compounds, it may possess unique properties such as increased metabolic stability and altered solubility compared to non-fluorinated analogs. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds. Overall, 1,1,1-Trifluoro-4-[(2-fluorophenyl)amino]-3-buten-2-one represents a valuable compound in the field of organic synthesis and drug development.
Formula:C10H7F4NO
InChI:InChI=1S/C10H7F4NO/c11-7-3-1-2-4-8(7)15-6-5-9(16)10(12,13)14/h1-6,15H
InChI key:InChIKey=UNXSUDIUJPYWBV-UHFFFAOYSA-N
SMILES:N(C=CC(C(F)(F)F)=O)C1=C(F)C=CC=C1
Synonyms:
  • 3-Buten-2-one, 1,1,1-trifluoro-4-[(2-fluorophenyl)amino]-
  • 1,1,1-Trifluoro-4-[(2-fluorophenyl)amino]-3-buten-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.