CAS 380481-66-3
:4-Methylbenzeneboronic acid neopentyl glycol ester
Description:
4-Methylbenzeneboronic acid neopentyl glycol ester, with the CAS number 380481-66-3, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 4-methylphenyl moiety and esterified with neopentyl glycol. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols and other Lewis bases, making it useful in various applications, including organic synthesis and materials science. The presence of the methyl group on the aromatic ring can influence its reactivity and solubility, while the neopentyl glycol moiety contributes to its stability and hydrophobic characteristics. This compound may also play a role in medicinal chemistry, particularly in the development of boron-containing drugs. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 4-Methylbenzeneboronic acid neopentyl glycol ester is a versatile compound with significant potential in both research and industrial applications.
Formula:C12H17BO2
InChI:InChI=1/C12H17BO2/c1-10-4-6-11(7-5-10)13-14-8-12(2,3)9-15-13/h4-7H,8-9H2,1-3H3
SMILES:Cc1ccc(cc1)B1OCC(C)(C)CO1
Synonyms:- p-Tolylboronic acid neopentyl glycol ester~2-(p-Tolyl)-5,5-dimethyl-1,3,2-dioxaborinane
- 5,5-Dimethyl-2-(4-Methylphenyl)-1,3,2-Dioxaborinane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methylbenzeneboronic acid neopentyl glycol ester, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H17BO2Purity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:204.084-Methylbenzeneboronic acid neopentyl ester
CAS:Formula:C12H17BO2Purity:98%Color and Shape:SolidMolecular weight:204.07324-Methylbenzeneboronic acid, neopentyl glycol ester
CAS:4-Methylbenzeneboronic acid, neopentyl glycol esterPurity:98%Molecular weight:204.07317g/mol5,5-Dimethyl-2-(p-tolyl)-1,3,2-dioxaborinane
CAS:Formula:C12H17BO2Purity:98%Color and Shape:SolidMolecular weight:204.08



