CAS 380482-31-5: Benzoic acid, 3,4-diethoxy-, hydrazide
Description:Benzoic acid, 3,4-diethoxy-, hydrazide is an organic compound characterized by its hydrazide functional group attached to a benzoic acid moiety, specifically at the 3 and 4 positions of the aromatic ring, which are substituted with ethoxy groups. This compound typically exhibits properties associated with both hydrazides and benzoic acids, such as potential acidity due to the carboxylic acid group and reactivity due to the hydrazide functionality. It may be used in various applications, including as an intermediate in organic synthesis or in pharmaceutical research. The presence of ethoxy groups can influence its solubility and reactivity, making it more hydrophobic compared to other hydrazides. Additionally, the compound may exhibit biological activity, which is often a focus in medicinal chemistry. Its molecular structure contributes to its unique physical and chemical properties, including melting point, boiling point, and stability under various conditions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H16N2O3
InChI:InChI=1S/C11H16N2O3/c1-3-15-9-6-5-8(11(14)13-12)7-10(9)16-4-2/h5-7H,3-4,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=UXWHTJPMGMMDNV-UHFFFAOYSA-N
SMILES:O=C(NN)C1=CC=C(OCC)C(OCC)=C1
- Synonyms:
- 3,4-Diethoxy-benzoic acid hydrazide
- 3,4-Diethoxybenzhydrazide
- Benzoic acid, 3,4-diethoxy-, hydrazide
- 3,4-Diethoxybenzohydrazide
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3,4-Diethoxybenzhydrazide REF: 10-F018551CAS: 380482-31-5 | 95+% | 71.00 €~235.00 € | Fri 25 Apr 25 |
 | 3,4-Diethoxybenzohydrazide REF: IN-DA0076G5CAS: 380482-31-5 | - - - | To inquire | Tue 29 Apr 25 |
 | 3,4-Diethoxybenzohydrazide REF: 54-OR1021393CAS: 380482-31-5 | - - - | 155.00 € | Wed 30 Apr 25 |
 | 3,4-Diethoxybenzohydrazide REF: 3D-FD114312CAS: 380482-31-5 | Min. 95% | - - - | Discontinued product |
3,4-Diethoxybenzhydrazide
Ref: 10-F018551
| 1g | 71.00 € | ||
| 5g | 235.00 € |
3,4-Diethoxybenzohydrazide
Ref: IN-DA0076G5
| Undefined size | To inquire |
3,4-Diethoxybenzohydrazide
Ref: 3D-FD114312
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
