CAS 3805-37-6
:2′,5′-ADP
Description:
2′,5′-ADP, or 2′,5′-adenosine diphosphate, is a nucleotide that plays a crucial role in cellular metabolism and signaling. It is a derivative of adenosine, consisting of an adenine base, a ribose sugar, and two phosphate groups linked by high-energy bonds. The unique 2′,5′-phosphate linkage distinguishes it from the more common 3′,5′-ADP, influencing its biochemical functions. This compound is involved in various cellular processes, including energy transfer and the regulation of enzymatic activities. It can act as a signaling molecule in certain pathways, particularly in the context of RNA metabolism and protein synthesis. The CAS number 3805-37-6 identifies this specific compound in chemical databases, facilitating its study and application in research. 2′,5′-ADP is typically found in low concentrations within cells and can be synthesized or degraded by specific enzymes, highlighting its dynamic role in cellular biochemistry. Its properties and interactions are of interest in fields such as molecular biology, biochemistry, and pharmacology.
Formula:C10H15N5O10P2
InChI:InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(25-27(20,21)22)6(16)4(24-10)1-23-26(17,18)19/h2-4,6-7,10,16H,1H2,(H2,11,12,13)(H2,17,18,19)(H2,20,21,22)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=AEOBEOJCBAYXBA-KQYNXXCUSA-N
SMILES:O(P(=O)(O)O)[C@H]1[C@@H](O[C@H](COP(=O)(O)O)[C@H]1O)N2C=3C(N=C2)=C(N)N=CN3
Synonyms:- Adenosine 2′,5′-diphosphate
- 2′-Adenylic acid, 5′-(dihydrogen phosphate)
- Adenosine, 2′,5′-bis(dihydrogen phosphate)
- Adenosine 2′,5′-bisphosphate
- 2′,5′-ADP
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
