CymitQuimica logo

CAS 380605-28-7

:

N-Cyclopropyl-3-nitro-4-pyridinamine

Description:
N-Cyclopropyl-3-nitro-4-pyridinamine is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a nitro group and an amine group, along with a cyclopropyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyridine and cyclopropyl moieties. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents. The nitro group contributes to its reactivity, making it a candidate for various chemical transformations. Additionally, the presence of the amine group may impart basic characteristics, allowing for interactions with acids and other electrophiles. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous. Overall, N-Cyclopropyl-3-nitro-4-pyridinamine represents a versatile structure with potential applications in various fields of chemistry.
Formula:C8H9N3O2
InChI:InChI=1S/C8H9N3O2/c12-11(13)8-5-9-4-3-7(8)10-6-1-2-6/h3-6H,1-2H2,(H,9,10)
InChI key:InChIKey=OXWIUZUWZJVMSR-UHFFFAOYSA-N
SMILES:N(C=1C(N(=O)=O)=CN=CC1)C2CC2
Synonyms:
  • 4-(Cyclopropylamino)-3-Nitropyridine
  • 4-Pyridinamine, N-cyclopropyl-3-nitro-
  • Cyclopropyl(3-nitropyridin-4-yl)amine
  • N-Cyclopropyl-3-nitro-4-pyridinamine
Found 3 products.