CAS 380608-76-4

N-Cyclopentyl-2-pyrrolidinecarboxamide

Description:

N-Cyclopentyl-2-pyrrolidinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a cyclopentyl group. This compound is classified as an amide due to the presence of the carboxamide functional group. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, which is common for many amides. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to various therapeutic applications. Additionally, the presence of the cyclopentyl group may influence its lipophilicity and overall bioavailability. As with many chemical substances, safety and handling precautions are essential, as it may pose risks if ingested or improperly handled. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential applications in various fields.

Formula: C₁₀H₁₈N₂O

InChI: InChI=1S/C10H18N2O/c13-10(9-6-3-7-11-9)12-8-4-1-2-5-8/h8-9,11H,1-7H2,(H,12,13)

InChI key: InChIKey=KJVQYUFCITWYMX-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCCN1)C2CCCC2

Synonyms:

• 2-Pyrrolidinecarboxamide, N-cyclopentyl-
• N-Cyclopentyl-2-pyrrolidinecarboxamide