CymitQuimica logo

CAS 380626-81-3

:

ethyl 4-amino-6-chloronicotinate

Description:
Ethyl 4-amino-6-chloronicotinate is a chemical compound characterized by its structure, which includes a nicotinic acid derivative with an ethyl ester group, an amino group, and a chlorine atom. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents. Its molecular structure features a pyridine ring, which contributes to its potential biological activity. Ethyl 4-amino-6-chloronicotinate may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to the presence of the amino and halogen substituents that can participate in various chemical reactions. Additionally, the compound may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a unique combination of functional groups that may lend itself to diverse applications in research and industry.
Formula:C8H9ClN2O2
InChI:InChI=1S/C8H9ClN2O2/c1-2-13-8(12)5-4-11-7(9)3-6(5)10/h3-4H,2H2,1H3,(H2,10,11)
InChI key:OAQIVHCEAFDMTK-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN=C(C=C1N)Cl
Synonyms:
  • 4-Amino-6-chloro-nicotinic acid ethyl ester
  • Ethyl 4-amino-6-chloro-pyridine-3-carboxylate
  • 4-Amino-6-Chloropyridine-3-Carboxylic Acid Ethyl Ester
Found 4 products.