CAS 38063-81-9
:1-(4-aminophenyl)ethan-1-one oxime
Description:
1-(4-Aminophenyl)ethan-1-one oxime, also known by its CAS number 38063-81-9, is an organic compound characterized by the presence of both an oxime functional group and an aromatic amine. This compound features a phenyl ring substituted with an amino group at the para position, which contributes to its reactivity and potential applications in various chemical processes. The oxime group, derived from the ketone structure, imparts unique properties, including the ability to form coordination complexes with metal ions. Typically, this compound appears as a solid or crystalline substance and is soluble in polar organic solvents. Its chemical structure allows for potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Additionally, the presence of both the amino and oxime functionalities may influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H10N2O
InChI:InChI=1/C8H10N2O/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,9H2,1H3/b10-6+
Synonyms:- (1E)-1-(4-aminophenyl)ethanone oxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(4-Aminophenyl)ethanone oxime
CAS:<p>4-Aminoacetophenone oxime is an organic compound that is soluble in water and methanol. It has a molecular weight of 169.17 g/mol, a melting point of 190 °C, and a boiling point of 260 °C. 4-Aminoacetophenone oxime has been shown to have antimicrobial activity against Gram-positive bacteria, such as Staphylococcus aureus, but not against Gram-negative bacteria. This compound can be used as a ligand for metal ions such as copper and zinc, which are important in biological processes. The magnetic properties of 4-aminoacetophenone oxime make it possible to detect the molecule using nuclear magnetic resonance spectroscopy.<br>4-Aminoacetophenone oxime can be synthesized by reacting 5-nitrosalicylaldehyde with ammonium acetate in the presence of hydrochloric acid:</p>Formula:C8H10N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:150.18 g/mol

