CAS 3807-80-5

5,8-dinitro-1H,3H-benzo[de]isochromene-1,3-dione

Description:

5,8-Dinitro-1H,3H-benzo[de]isochromene-1,3-dione, with the CAS number 3807-80-5, is a synthetic organic compound characterized by its complex aromatic structure, which includes a benzoisochromene core with two nitro groups and a dione functional group. This compound typically exhibits a yellow to orange color due to the presence of conjugated systems, which can also influence its optical properties. It is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and pigments. The nitro groups contribute to its reactivity, making it a candidate for further chemical modifications. Additionally, the presence of the dione functionality suggests that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Safety considerations are important when handling this compound, as nitro compounds can be sensitive to heat and shock, and may pose environmental hazards. Overall, 5,8-dinitro-1H,3H-benzo[de]isochromene-1,3-dione is a notable compound in the field of organic chemistry due to its unique structure and reactivity.

Formula: C₁₂H₄N₂O₇

InChI: InChI=1/C12H4N2O7/c15-11-8-3-6(13(17)18)1-5-2-7(14(19)20)4-9(10(5)8)12(16)21-11/h1-4H

SMILES: c1c2cc(cc3c2c(cc1N(=O)=O)C(=O)OC3=O)N(=O)=O

Synonyms:

• 1H,3H-Benzo[de]isochromene-1,3-dione, 5,8-dinitro-
• 1H,3H-naphtho[1,8-cd]pyran-1,3-dione, 5,8-dinitro-

3,6-Dinitro-1,8-naphthalenedicarboxylicanhydride

CAS: 3807-80-5

3,6-Dinitro-1,8-naphthalenedicarboxylic anhydride is a fine chemical that is used as a building block in the synthesis of other compounds. It is also used as a reagent and can be found in research chemicals with CAS No. 3807-80-5. 3,6-Dinitro-1,8-naphthalenedicarboxylic anhydride is versatile and has many uses as a reaction component. The compound can be used to produce complex compounds or scaffolds that are useful in research.

Formula: C₁₂H₄N₂O₇

Purity: Min. 95%

Color and Shape: Beige Powder

Molecular weight: 288.17 g/mol

Ref: 3D-FD22430

3,6-Dinitronaphthalic Anhydride

Controlled Product

CAS: 3807-80-5

Applications A dinitronaphthaloyl derivative as disinfectants and antiseptics.
References Brana, M., et al.: Anti-Cancer Drug Des., 8, 257 (1993), Griffin, B., et al.: Science, 281, 269 (1998), Huh, W., et al.: Nature, 425, 686 (2003),

Formula: C₁₂H₄N₂O₇

Color and Shape: Neat

Molecular weight: 288.17

Ref: TR-D479950