CAS 38072-88-7

Pterolactam

Description:

Pterolactam, identified by the CAS number 38072-88-7, is a cyclic amide that belongs to the class of lactams. It is characterized by its unique bicyclic structure, which includes a pteridine moiety. Pterolactam is typically a white to off-white solid and is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but has limited solubility in water. This compound exhibits interesting biological properties, making it of interest in medicinal chemistry and pharmaceutical research. Its structure allows for potential interactions with biological targets, which can lead to various pharmacological effects. Pterolactam may also participate in chemical reactions typical of lactams, such as hydrolysis and ring-opening reactions, under appropriate conditions. Due to its specific structural features, it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. As with any chemical substance, handling should be conducted with care, following appropriate safety protocols to mitigate any potential hazards.

Formula: C₅H₉NO₂

InChI: InChI=1/C5H9NO2/c1-8-5-3-2-4(7)6-5/h5H,2-3H2,1H3,(H,6,7)

InChI key: InChIKey=VULIHENHKGDFAB-UHFFFAOYNA-N

SMILES: O(C)C1NC(=O)CC1

Synonyms:

• 2-Pyrrolidinone, 5-methoxy-, (+)-
• Pterolactam
• (+)-5-Methoxy-2-pyrrolidinone

5-Methoxypyrrolidin-2-one

CAS: 38072-88-7

Formula: C₅H₉NO₂

Molecular weight: 115.1305

Ref: IN-DA00CHVP

Pterolactam

CAS: 38072-88-7

Pterolactam is a natural product of Cibotium, Dicksoniaceae.

Formula: C₅H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 115.13

Ref: TM-TN4855

Pterolactam

CAS: 38072-88-7

Formula: C₅H₉NO₂

Purity: 95%~99%

Color and Shape: Oil

Molecular weight: 115.132

Ref: BP-SBP00214

Pterolactam

CAS: 38072-88-7

Pterolactam is a bioactive compound that is classified as a lactam, which is a cyclic amide. This compound is derived from microbial sources, specifically certain species of bacteria or fungi. The precise biosynthetic pathways involve enzymatic processes that cyclize linear precursors, resulting in the formation of the lactam ring, a key structural feature of Pterolactam.

Formula: C₅H₉NO₂

Purity: Min. 95%

Molecular weight: 115.13 g/mol

Ref: 3D-NBA07288