CAS 38072-94-5: 8-(Methyl-d3)naphthalene-1,2,3,4,5,6,7-d7
Description:8-(Methyl-d3)naphthalene-1,2,3,4,5,6,7-d7 is a deuterated derivative of naphthalene, a polycyclic aromatic hydrocarbon. This compound features a naphthalene core, which consists of two fused benzene rings, with specific hydrogen atoms replaced by deuterium isotopes, enhancing its utility in various analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy. The presence of deuterium, a stable isotope of hydrogen, allows for improved resolution and sensitivity in NMR studies, making it valuable in research involving molecular dynamics and interactions. The methyl-d3 group indicates that three hydrogen atoms in the methyl group have been replaced with deuterium, further contributing to its unique spectral characteristics. This compound is typically used in scientific research, particularly in studies involving isotopic labeling, and can serve as a standard or reference material in various chemical analyses. Its stability and relatively low reactivity make it suitable for a range of experimental conditions.
Formula:C11D10
InChI:InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3/i1D3,2D,3D,4D,5D,6D,7D,8D
InChI key:InChIKey=QPUYECUOLPXSFR-UZHHFJDZSA-N
SMILES:C=1C=CC2=C(C1)C=CC=C2C
- Synonyms:
- 1-(2
- 1-Methylnaphthalene-d<sub>10</sub>
- 8-(Methyl-d<sub>3</sub>)naphthalene-1,2,3,4,5,6,7-d<sub>7</sub>
- Naphthalene-1,2,3,4,5,6,7-D7
- Naphthalene-1,2,3,4,5,6,7-d<sub>7</sub>, 8-(methyl-d<sub>3</sub>)-
- 1-Methylnaphthalene-d10
- 8-(Methyl-d3)naphthalene-1,2,3,4,5,6,7-d7
- Naphthalene-1,2,3,4,5,6,7-d7, 8-(methyl-d3)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Methylnaphthalene-d10 REF: 3U-D1300CAS: 38072-94-5 | 98 atom % D | 253.00 € | Wed 16 Apr 25 |
![]() | 1-Methylnaphthalene D10 REF: 04-C20895100CAS: 38072-94-5 | - - - | 97.00 € | Thu 17 Apr 25 |
![]() | 1-Methylnaphthalene-d10 REF: TR-M323156CAS: 38072-94-5 | - - - | 94.00 €~119.00 € | Tue 27 May 25 |

1-Methylnaphthalene-d10
Ref: 3U-D1300
500mg | 253.00 € |

1-Methylnaphthalene D10
Controlled ProductRef: 04-C20895100
10mg | 97.00 € |

1-Methylnaphthalene-d10
Controlled ProductRef: TR-M323156
5mg | 94.00 € | ||
10mg | 119.00 € |