CAS 38077-12-2
:1-(4-fluorophenyl)-4-{4-[(4-fluorophenyl)(hydroxy)methyl]piperidin-1-yl}butan-1-one
Description:
1-(4-Fluorophenyl)-4-{4-[(4-fluorophenyl)(hydroxy)methyl]piperidin-1-yl}butan-1-one, with CAS number 38077-12-2, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and multiple fluorophenyl groups. This compound typically exhibits properties associated with its functional groups, such as potential lipophilicity due to the presence of aromatic rings, which can influence its solubility and biological activity. The hydroxymethyl group may contribute to its reactivity and interactions with biological targets. As a member of the class of compounds known as ketones, it may participate in various chemical reactions, including nucleophilic additions and reductions. The presence of fluorine atoms can enhance the compound's metabolic stability and alter its pharmacokinetic properties. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and structural features. However, specific biological effects and applications would require further investigation and research.
Formula:C22H25F2NO2
InChI:InChI=1/C22H25F2NO2/c23-19-7-3-16(4-8-19)21(26)2-1-13-25-14-11-18(12-15-25)22(27)17-5-9-20(24)10-6-17/h3-10,18,22,27H,1-2,11-15H2
SMILES:C(CC(=O)c1ccc(cc1)F)CN1CCC(CC1)C(c1ccc(cc1)F)O
Synonyms:- 1-(4-Fluorophenyl)-4-(4-((4-fluorophenyl)(hydroxy)methyl)-1-piperidinyl)-1-butanone
- 1-Butanone, 1-(4-Fluorophenyl)-4-[4-[(4-Fluorophenyl)Hydroxymethyl]-1-Piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dihydrolenperone
CAS:Dihydrolenperone has vitro activity against non-small cell lung cancer.Formula:C22H25F2NO2Color and Shape:SolidMolecular weight:373.44
