CymitQuimica logo

CAS 38078-71-6

:

4-cyano-tempo

Description:
4-Cyano-TEMPO, with the CAS number 38078-71-6, is a stable free radical compound that belongs to the class of nitroxides. It is characterized by the presence of a cyano group (-CN) attached to the 4-position of the TEMPO (2,2,6,6-tetramethylpiperidinyl-1-oxyl) structure. This compound exhibits notable stability due to the resonance of the unpaired electron, which contributes to its radical character. 4-Cyano-TEMPO is often utilized in various applications, including as a spin label in electron paramagnetic resonance (EPR) spectroscopy and as an antioxidant in polymer chemistry. Its radical nature allows it to participate in redox reactions, making it useful in studying reaction mechanisms and kinetics. Additionally, the cyano group enhances its solubility in polar solvents and can influence its reactivity. Overall, 4-cyano-TEMPO is a versatile compound with significant implications in both academic research and industrial applications.
Formula:C10H18N2O
InChI:InChI=1/C10H18N2O/c1-9(2)5-8(7-11)6-10(3,4)12(9)13/h8,13H,5-6H2,1-4H3
SMILES:CC1(C)CC(CC(C)(C)N1O)C#N
Synonyms:
  • 1-Hydroxy-2,2,6,6-Tetramethylpiperidine-4-Carbonitrile
Found 5 products.