CAS 3808-87-5
:Bis(2,4,5-trichlorophenyl) disulfide
Description:
Bis(2,4,5-trichlorophenyl) disulfide, with the CAS number 3808-87-5, is an organosulfur compound characterized by its disulfide linkage between two 2,4,5-trichlorophenyl groups. This compound is typically a solid at room temperature and is known for its stability and resistance to degradation. It exhibits a high degree of chlorination, which contributes to its lipophilicity and potential bioaccumulation in the environment. Bis(2,4,5-trichlorophenyl) disulfide is primarily recognized for its use as a pesticide and in various industrial applications, particularly in the synthesis of other chemical compounds. Its chlorinated structure may impart significant toxicity to aquatic organisms and other wildlife, raising environmental concerns regarding its persistence and bioactivity. Safety measures are essential when handling this compound, as it may pose health risks through exposure. Overall, its chemical properties and environmental impact make it a subject of interest in both industrial chemistry and environmental science.
Formula:C12H4Cl6S2
InChI:InChI=1S/C12H4Cl6S2/c13-5-1-9(17)11(3-7(5)15)19-20-12-4-8(16)6(14)2-10(12)18/h1-4H
InChI key:InChIKey=ZUVJVEOHQKNMPN-UHFFFAOYSA-N
SMILES:S(SC1=C(Cl)C=C(Cl)C(Cl)=C1)C2=C(Cl)C=C(Cl)C(Cl)=C2
Synonyms:- 1,1'-Disulfanediylbis(2,4,5-Trichlorobenzene)
- 1,2,4-Trichloro-5-[(2,4,5-trichlorophenyl)disulfanyl]benzene
- 2,2,4,4,5,5-Hexachlorophenyl disulphide~2,4,5-Trichlorophenyl disulphide
- Bis(2,4,5-trichlorophenyl) disulfide
- Bis(2,4,5-trichlorophenyl) disulphide
- Disulfide, bis(2,4,5-trichlorophenyl)
- NSC 238936
- NSC 677440
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bis(2,4,5-trichlorophenyl) Disulfide
CAS:Formula:C12H4Cl6S2Purity:95%Color and Shape:SolidMolecular weight:425.0082Bis(2,4,5-Trichlorophenyl) Disulfide
CAS:Bis(2,4,5-Trichlorophenyl) DisulfidePurity:95%Molecular weight:424.98g/molBis(2,4,5-trichlorophenyl) Disulfide
CAS:Bis(2,4,5-trichlorophenyl) Disulfide is a colorless to yellow liquid with a sweet odor. It has a high solubility in water and organic solvents. It is soluble in benzene, ether, chloroform and acetone. Bis(2,4,5-trichlorophenyl) Disulfide has been shown to be an anti-markovnikov addition agent for styrene in the presence of copper salts. Bis(2,4,5-trichlorophenyl) Disulfide is used as a test organism to evaluate the toxicity of chemicals and pesticides on invertebrates such as shrimp and lobster larvae at different temperatures.Formula:C12H4Cl6S2Purity:Min. 95%Molecular weight:424.98 g/mol



