CAS 380844-03-1

2,4-Dichloro-5-propoxybenzenamine

Description:

2,4-Dichloro-5-propoxybenzenamine, identified by its CAS number 380844-03-1, is an organic compound that belongs to the class of anilines, which are characterized by the presence of an amino group attached to an aromatic ring. This compound features two chlorine atoms and a propoxy group substituent on the benzene ring, contributing to its unique chemical properties. The presence of chlorine atoms typically enhances the compound's reactivity and may influence its solubility in various solvents. The propoxy group, being an alkoxy substituent, can affect the compound's hydrophobicity and overall stability. In terms of applications, compounds like 2,4-Dichloro-5-propoxybenzenamine may be utilized in the synthesis of dyes, agrochemicals, or pharmaceuticals, although specific applications would depend on further research and development. Safety and handling considerations are essential, as with many chlorinated compounds, due to potential toxicity and environmental impact. Proper storage and disposal methods should be followed to mitigate any risks associated with its use.

Formula: C₉H₁₁Cl₂NO

InChI: InChI=1S/C9H11Cl2NO/c1-2-3-13-9-5-8(12)6(10)4-7(9)11/h4-5H,2-3,12H2,1H3

InChI key: InChIKey=FIUDAEISGGHCLE-UHFFFAOYSA-N

SMILES: O(CCC)C1=C(Cl)C=C(Cl)C(N)=C1

Synonyms:

• 2,4-Dichloro-5-propoxyaniline
• 2,4-Dichloro-5-propoxybenzenamine
• Benzenamine, 2,4-dichloro-5-propoxy-