CAS 38086-00-9
:Diethylene glycol dimethyl ether-d{14}
Description:
Diethylene glycol dimethyl ether-d14, with the CAS number 38086-00-9, is a deuterated form of diethylene glycol dimethyl ether, which is an organic compound commonly used as a solvent and in various chemical applications. This substance features a molecular structure that includes two ether groups and is characterized by its relatively low viscosity and high boiling point, making it suitable for use in high-temperature applications. The presence of deuterium (d14) indicates that certain hydrogen atoms in the molecule have been replaced with deuterium isotopes, which can be useful in studies involving nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques. Diethylene glycol dimethyl ether-d14 is typically colorless and has a mild odor. It is miscible with water and many organic solvents, enhancing its utility in various formulations. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C6D14O3
InChI:InChI=1/C6H14O3/c1-7-3-5-9-6-4-8-2/h3-6H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2
SMILES:C(OC(C(OC(C(OC([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:- 1,1,2,2-Tetradeuterio-1-[1,1,2,2-Tetradeuterio-2-(Trideuteriomethoxy)Ethoxy]-2-(Trideuteriomethoxy)Ethane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diglyme-d14
CAS:Controlled Product<p>Applications Diglyme-d14, is the labeled analogue of Diglyme (D446300), a solvent, that is used as reaction medium for Grignard and similar synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Merck Index, 11th Edition, 3148.<br></p>Formula:C62H14O3Color and Shape:NeatMolecular weight:148.26
