CAS 380889-69-0
:5-(4-Fluorophenyl)-2-furoyl chloride
Description:
5-(4-Fluorophenyl)-2-furoyl chloride is an organic compound characterized by its furoyl chloride structure, which includes a furan ring and a chlorinated carbonyl group. The presence of the 4-fluorophenyl substituent enhances its reactivity and may influence its physical properties, such as solubility and boiling point. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. It is known for its reactivity, particularly in nucleophilic substitution reactions, where the acyl chloride functional group can react with amines, alcohols, and other nucleophiles to form corresponding amides or esters. The fluorine atom in the para position of the phenyl ring can affect the electronic properties of the molecule, potentially increasing its electrophilicity. Due to its chemical structure, 5-(4-Fluorophenyl)-2-furoyl chloride may find applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Proper handling and storage are essential, as it may be corrosive and sensitive to moisture.
Formula:C11H6ClFO2
InChI:InChI=1/C11H6ClFO2/c12-11(14)10-6-5-9(15-10)7-1-3-8(13)4-2-7/h1-6H
SMILES:c1cc(ccc1c1ccc(C(=O)Cl)o1)F
Synonyms:- 2-Furancarbonyl Chloride, 5-(4-Fluorophenyl)-
- 5-(4-Fluorophenyl)Furan-2-Carbonyl Chloride
- 5-(4-Fluorophenyl)-2-furoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
