CAS 38090-53-8
:(2E)-4-aminobut-2-enoic acid
Description:
(2E)-4-aminobut-2-enoic acid, commonly known as L-2-amino-4-butenoic acid or simply as a derivative of amino acids, is an organic compound characterized by its structure, which features a double bond between the second and third carbon atoms in a four-carbon chain, along with an amino group (-NH2) and a carboxylic acid group (-COOH). This compound is a colorless to pale yellow solid that is soluble in water, reflecting its polar functional groups. It plays a role in various biochemical processes and is of interest in research related to amino acid metabolism and potential therapeutic applications. The presence of the amino group makes it a basic compound, while the carboxylic acid group contributes to its acidic properties. Its unique structure allows it to participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. As a compound with potential biological significance, it is studied for its role in metabolic pathways and its possible applications in pharmaceuticals and nutrition.
Formula:C4H7NO2
InChI:InChI=1/C4H7NO2/c5-3-1-2-4(6)7/h1-2H,3,5H2,(H,6,7)/b2-1+
Synonyms:- 2-Butenoic acid, 4-amino-, (2E)-
- (2E)-4-Aminobut-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
TACA
CAS:<p>Stability Light sensitive, temperature sensitive, unstable in solution<br>Applications TACA is a GABAA and GABAC agonist or antagonist for use in the treatment of vascular diseases, also used in the studies on cancer vaccines and carbohydrate epitopes.<br>References Bek, T., et al.: PCT Int. Appl. (2012), WO 2012126472 A1 20120927; Heimburg-Molinaro, J., et al.: Vaccine, 29, 8802 (2011)<br></p>Formula:C4H7NO2Color and Shape:Off White SolidMolecular weight:101.104
