CAS 381-98-6
:2-(Trifluoromethyl)acrylic acid
Description:
2-(Trifluoromethyl)acrylic acid, with the CAS number 381-98-6, is an organic compound characterized by the presence of both an acrylic acid functional group and a trifluoromethyl group. This compound features a double bond between the first and second carbon atoms of the acrylic acid moiety, which contributes to its reactivity and potential applications in polymer chemistry and organic synthesis. The trifluoromethyl group, known for its electron-withdrawing properties, enhances the acidity of the carboxylic acid functional group, making it a stronger acid compared to its non-fluorinated counterparts. This compound is typically a colorless liquid or solid, depending on the temperature, and is soluble in organic solvents. Its unique properties make it valuable in the synthesis of fluorinated polymers and pharmaceuticals. Additionally, the presence of fluorine atoms can impart desirable characteristics such as increased thermal stability and chemical resistance. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H3F3O2
InChI:InChI=1S/C4H3F3O2/c1-2(3(8)9)4(5,6)7/h1H2,(H,8,9)
InChI key:InChIKey=VLSRKCIBHNJFHA-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(O)=O)=C
Synonyms:- 2-(Trifluoromethyl)acrylic acid
- α-(Trifluoromethyl)acrylic acid
- Acrylic acid, 2-(trifluoromethyl)-
- 2-Propenoic acid, 2-(trifluoromethyl)-
- 2-(Trifluoromethyl)-2-propenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Trifluoromethyl)acrylic Acid
CAS:Formula:C4H3F3O2Purity:>98.0%(T)Color and Shape:White to Light yellow to Light red powder to crystalineMolecular weight:140.062-(Trifluoromethyl)acrylic acid, 98%
CAS:2-(Trifluoromethyl)acrylic acid is used as an acidic functional monomer for molecular imprinting of nicotine. And also used in the conventional functional monomer methacrylic acid. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentat
Formula:C4H2F3O2Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powder or fused solidMolecular weight:139.052-(Trifluoromethyl)propenoic acid
CAS:Formula:C4H3F3O2Purity:98%Color and Shape:SolidMolecular weight:140.06062-(Trifluoromethyl)acrylic acid
CAS:2-(Trifluoromethyl)acrylic acidFormula:C4H3F3O2Purity:98%Color and Shape: white crystalline solidMolecular weight:140.06g/mol2-(Trifluoromethyl)propenoic acid
CAS:Formula:C4H3F3O2Purity:98%Color and Shape:SolidMolecular weight:140.061




