CAS 38102-67-9: 4-(3-methoxyphenyl)-4-oxobutanoic acid

Description:4-(3-Methoxyphenyl)-4-oxobutanoic acid, identified by its CAS number 38102-67-9, is an organic compound characterized by its functional groups and structural features. It contains a butanoic acid backbone with a ketone group at the fourth carbon and a methoxy-substituted phenyl group at the first carbon. This compound exhibits both acidic and aromatic properties, making it a versatile molecule in organic synthesis and medicinal chemistry. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can participate in various chemical reactions, including esterification and acylation, and may serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's solubility, stability, and reactivity can be influenced by the pH of the environment and the presence of other functional groups. Overall, 4-(3-methoxyphenyl)-4-oxobutanoic acid is of interest for its potential applications in drug development and material science.

Formula:C₁₁H₁₂O₄

InChI:InChI=1/C11H12O4/c1-15-9-4-2-3-8(7-9)10(12)5-6-11(13)14/h2-4,7H,5-6H2,1H3,(H,13,14)