CAS 38103-05-8

2,2-Bis[4-(3,4-dicarboxyphenoxy)phenyl]propane

Description:

2,2-Bis[4-(3,4-dicarboxyphenoxy)phenyl]propane, commonly referred to as bisphenol A derivative, is a synthetic organic compound characterized by its complex structure featuring multiple aromatic rings and carboxylic acid functional groups. This compound is typically used in the production of high-performance polymers and resins due to its excellent thermal stability and mechanical properties. It exhibits good solubility in organic solvents and can participate in various chemical reactions, making it versatile for applications in materials science. The presence of dicarboxylic acid groups enhances its reactivity, allowing for further functionalization or cross-linking in polymer matrices. Additionally, its structural features contribute to its potential use in the development of advanced materials, including those with enhanced flame retardancy and chemical resistance. Safety and environmental considerations are essential when handling this compound, as with many synthetic chemicals, due to potential toxicity and ecological impact. Overall, 2,2-Bis[4-(3,4-dicarboxyphenoxy)phenyl]propane is significant in the field of polymer chemistry and materials engineering.

Formula: C₃₁H₂₄O₁₀

InChI: InChI=1S/C31H24O10/c1-31(2,17-3-7-19(8-4-17)40-21-11-13-23(27(32)33)25(15-21)29(36)37)18-5-9-20(10-6-18)41-22-12-14-24(28(34)35)26(16-22)30(38)39/h3-16H,1-2H3,(H,32,33)(H,34,35)(H,36,37)(H,38,39)

InChI key: InChIKey=KJLPSBMDOIVXSN-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC=C(OC2=CC(C(O)=O)=C(C(O)=O)C=C2)C=C1)C3=CC=C(OC4=CC(C(O)=O)=C(C(O)=O)C=C4)C=C3

Synonyms:

• 2,2-Bis[4-(3,4-dicarboxyphenoxy)phenyl]propane
• 1,2-Benzenedicarboxylic acid, 4,4′-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis-
• 4,4′-[(isopropylidene)bis(4,1-phenylene)dioxy]bis(1,2-benzenedicarboxylic acid)
• 4,4′-[(1-Methylethylidene)bis(4,1-phenyleneoxy)]bis[1,2-benzenedicarboxylic acid]
• BTB 13888

Lockdown

CAS: 38103-05-8

Lockdown selectively inhibits PPM1F non-competitively and reversibly, without affecting other phosphatases or PPM1F knockout cells.

Formula: C₃₁H₂₄O₁₀

Color and Shape: Solid

Molecular weight: 556.52

Ref: TM-T71845