CAS 38103-61-6

Tolamolol

Description:

Tolamolol is a beta-adrenergic antagonist, primarily used in the treatment of hypertension and certain types of glaucoma. It functions by blocking beta-adrenergic receptors, which leads to a decrease in heart rate and blood pressure. This compound is characterized by its ability to selectively inhibit beta-1 receptors, making it effective in managing cardiovascular conditions. Tolamolol is typically administered in the form of its hydrochloride salt, which enhances its solubility and bioavailability. The substance is known for its relatively low side effect profile compared to other beta-blockers, although potential adverse effects may include fatigue, dizziness, and bradycardia. Its pharmacokinetics involve oral absorption, with a moderate half-life that allows for once or twice daily dosing. Additionally, Tolamolol's chemical structure includes specific functional groups that contribute to its activity and solubility, making it a valuable therapeutic agent in clinical settings. As with any medication, it is essential to use Tolamolol under medical supervision to monitor for efficacy and potential interactions with other drugs.

Formula: C₁₉H₂₄N₂O₄

InChI: InChI=1S/C19H24N2O4/c1-14-4-2-3-5-18(14)25-13-16(22)12-21-10-11-24-17-8-6-15(7-9-17)19(20)23/h2-9,16,21-22H,10-13H2,1H3,(H2,20,23)

InChI key: InChIKey=SKQDKFOTIPJUSV-UHFFFAOYSA-N

SMILES: O(CC(CNCCOC1=CC=C(C(N)=O)C=C1)O)C2=C(C)C=CC=C2

Synonyms:

• dl-UK 6558
• Tolamolol
• 4-[2-[[2-Hydroxy-3-(2-methylphenoxy)propyl]amino]ethoxy]benzamide
• Benzamide, 4-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethoxy]-
• UK 6558

Tolamolol

CAS: 38103-61-6

Tolamolol is a selective β-adrenergic blocker that significantly reduces the degree of exercise-induced inhibition of the S-T segment and can be used in the

Formula: C₁₉H₂₄N₂O₄

Purity: 98.59%

Color and Shape: Solid

Molecular weight: 344.4

Ref: TM-T68164

Tolamolol

CAS: 38103-61-6

Tolamolol

Purity: ≥95%

Molecular weight: 344.4g/mol

Ref: 54-BUP03760