CAS 38115-12-7

5-phenylthiophene-3-carbaldehyde

Description:

5-Phenylthiophene-3-carbaldehyde is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a phenyl group attached to the thiophene ring and an aldehyde functional group (-CHO) at the 3-position. The presence of the aldehyde group makes it a reactive species, capable of participating in various chemical reactions, such as nucleophilic additions and condensation reactions. The thiophene moiety contributes to the compound's aromaticity and potential electronic properties, making it of interest in materials science and organic electronics. Additionally, the phenyl substituent can influence the compound's solubility and reactivity. 5-Phenylthiophene-3-carbaldehyde may be utilized in synthetic organic chemistry for the development of more complex molecules, including pharmaceuticals and agrochemicals. Its unique structure and functional groups provide avenues for further chemical modifications, enhancing its utility in various applications.

Formula: C₁₁H₈OS

InChI: InChI=1/C11H8OS/c12-7-9-6-11(13-8-9)10-4-2-1-3-5-10/h1-8H

SMILES: c1ccc(cc1)c1cc(C=O)cs1

Synonyms:

• 3-Thiophenecarboxaldehyde, 5-Phenyl-

5-Phenylthiophene-3-carbaldehyde

CAS: 38115-12-7

Versatile small molecule scaffold

Formula: C₁₁H₈OS

Purity: Min. 95%

Molecular weight: 188.25 g/mol

Ref: 3D-NBA11512