CAS 381178-60-5
:5-(2-Methyl-4-nitrophenyl)furan-2-carbonyl chloride
Description:
5-(2-Methyl-4-nitrophenyl)furan-2-carbonyl chloride is an organic compound characterized by its furan and aromatic nitrophenyl moieties. It features a carbonyl chloride functional group, which makes it a reactive acyl chloride, suitable for various chemical reactions, including acylation and coupling reactions. The presence of the nitro group on the aromatic ring contributes to the compound's electron-withdrawing properties, influencing its reactivity and stability. The methyl group on the aromatic ring can also affect the compound's sterics and electronic properties. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. As with many acyl chlorides, it is important to handle this substance with care, as it can be corrosive and may react with water to produce hydrochloric acid.
Formula:C12H8ClNO4
InChI:InChI=1/C12H8ClNO4/c1-7-6-8(14(16)17)2-3-9(7)10-4-5-11(18-10)12(13)15/h2-6H,1H3
SMILES:Cc1cc(ccc1c1ccc(C(=O)Cl)o1)N(=O)=O
Synonyms:- 2-Furancarbonyl Chloride, 5-(2-Methyl-4-Nitrophenyl)-
- 5-(2-Methyl-4-nitrophenyl)-2-furoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
