CAS 381242-61-1

1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine

Description:

1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a phenyl group substituted with both a nitro group and a trifluoromethyl group. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential biological activity. The trifluoromethyl group enhances lipophilicity and can affect the compound's pharmacokinetics and interaction with biological targets. This compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in the context of central nervous system disorders, due to the piperazine moiety's known activity in various pharmacological contexts. Additionally, the compound's stability, solubility, and overall behavior in biological systems can be influenced by the electronic effects of the substituents on the phenyl ring. Overall, 1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine represents a class of compounds that may exhibit interesting therapeutic properties, warranting further investigation.

Formula: C₁₁H₁₂F₃N₃O₂

InChI: InChI=1/C11H12F3N3O2/c12-11(13,14)9-7-8(17(18)19)1-2-10(9)16-5-3-15-4-6-16/h1-2,7,15H,3-6H2

SMILES: c1cc(c(cc1N(=O)=O)C(F)(F)F)N1CCNCC1

Synonyms:

• Piperazine, 1-[4-nitro-2-(trifluoromethyl)phenyl]-

1-(4-NITRO-2-TRIFLUOROMETHYLPHENYL)-PIPERAZINE

CAS: 381242-61-1

Formula: C₁₁H₁₂F₃N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 275.2271

Ref: IN-DA00C5LD

1-[4-Nitro-2-(trifluoromethyl)phenyl]piperazine

CAS: 381242-61-1

1-[4-Nitro-2-(trifluoromethyl)phenyl]piperazine

Purity: ≥95%

Molecular weight: 275.23g/mol

Ref: 54-PC9931

N-[4-Nitro-2-(trifluoromethyl)phenyl]piperazine

CAS: 381242-61-1

Formula: C₁₁H₁₂F₃N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 275.231

Ref: 10-F021297