CAS 381247-99-0

methyl 5-bromo-6-oxo-1,6-dihydropyridine-3-carboxylate

Description:

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-3-carboxylate is a chemical compound characterized by its pyridine ring structure, which features a bromine atom and a carbonyl group. This compound belongs to the class of dihydropyridines, which are known for their diverse biological activities, including potential applications in pharmaceuticals. The presence of the carboxylate group enhances its reactivity and solubility in polar solvents, making it suitable for various chemical reactions. The bromine substituent can serve as a useful handle for further functionalization, allowing for the synthesis of more complex molecules. Additionally, the compound's structure suggests potential interactions with biological targets, which may lead to interesting pharmacological properties. Its CAS number, 381247-99-0, provides a unique identifier for regulatory and research purposes. Overall, methyl 5-bromo-6-oxo-1,6-dihydropyridine-3-carboxylate is a versatile compound with significant implications in organic synthesis and medicinal chemistry.

Formula: C₇H₆BrNO₃

InChI: InChI=1/C7H6BrNO3/c1-12-7(11)4-2-5(8)6(10)9-3-4/h2-3H,1H3,(H,9,10)

SMILES: COC(=O)c1cc(c(nc1)O)Br

Synonyms:

• 3-Pyridinecarboxylic Acid, 5-Bromo-6-Hydroxy-, Methyl Ester
• Methyl 5-bromo-6-hydroxynicotinate

Methyl 5-bromo-6-hydroxynicotinate

CAS: 381247-99-0

Formula: C₇H₆BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.0314

Ref: IN-DA00BZH4

Methyl 5-bromo-6-hydroxynicotinate

CAS: 381247-99-0

Methyl 5-bromo-6-hydroxynicotinate

Formula: C₇H₆BrNO₃

Purity: 97%

Color and Shape: white solid

Molecular weight: 232.03g/mol

Ref: 54-OR6398

Methyl 5-bromo-6-hydroxynicotinate

CAS: 381247-99-0

Formula: C₇H₆BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 232.033

Ref: 10-F047298