CAS 38126-73-7
:L-gamma-glutamyl-S-(methylcarbamoyl)-L-cysteinylglycine
Description:
L-gamma-glutamyl-S-(methylcarbamoyl)-L-cysteinylglycine, identified by its CAS number 38126-73-7, is a synthetic peptide that features a unique combination of amino acids, specifically gamma-glutamic acid, cysteine, and glycine, with a methylcarbamoyl group attached to the cysteine residue. This compound is characterized by its potential biological activity, particularly in the context of cellular signaling and antioxidant properties. The presence of the gamma-glutamyl group may enhance its stability and bioavailability, while the cysteine component contributes to its reactivity and ability to form disulfide bonds. As a peptide, it is soluble in water and may exhibit specific interactions with biological macromolecules, influencing various physiological processes. Its structural complexity allows for diverse applications in biochemical research, particularly in studies related to peptide synthesis, drug design, and the exploration of therapeutic agents targeting oxidative stress and cellular signaling pathways. Further research is necessary to fully elucidate its mechanisms of action and potential therapeutic benefits.
Formula:C12H20N4O7S
InChI:InChI=1/C12H20N4O7S/c1-14-12(23)24-5-7(10(20)15-4-9(18)19)16-8(17)3-2-6(13)11(21)22/h6-7H,2-5,13H2,1H3,(H,14,23)(H,15,20)(H,16,17)(H,18,19)(H,21,22)/t6-,7-/m0/s1
SMILES:CN=C(O)SC[C@@H](C(=NCC(=O)O)O)N=C(CC[C@@H](C(=O)O)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
