CAS 38136-70-8
:Brevianamide F
Description:
Brevianamide F is a naturally occurring chemical compound classified as a cyclic amide, specifically an alkaloid. It is derived from certain species of fungi, particularly those belonging to the genus *Penicillium*. This compound is characterized by its unique structural features, which include a cyclic structure that contributes to its biological activity. Brevianamide F has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and cytotoxic effects. The compound's mechanism of action and specific interactions at the molecular level are subjects of ongoing research, as scientists explore its potential applications in drug development. Additionally, Brevianamide F is notable for its relatively low toxicity, making it a candidate for further studies in therapeutic contexts. Its solubility and stability in various solvents also play a crucial role in its usability in laboratory settings. Overall, Brevianamide F represents a fascinating area of study within natural product chemistry and its implications for health sciences.
Formula:C16H17N3O2
InChI:InChI=1S/C16H17N3O2/c20-15-14-6-3-7-19(14)16(21)13(18-15)8-10-9-17-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17H,3,6-8H2,(H,18,20)/t13-,14-/m0/s1
InChI key:InChIKey=RYFZBPVMVYTEKZ-KBPBESRZSA-N
SMILES:C(C=1C=2C(NC1)=CC=CC2)[C@H]3C(=O)N4[C@](C(=O)N3)(CCC4)[H]
Synonyms:- Brevianamide F
- Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(1H-indol-3-ylmethyl)-, (3S,8aS)-
- Cyclo-L-tryptophyl-L-proline
- Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(1H-indol-3-ylmethyl)-, (3S-trans)-
- (3S,8aS)-Hexahydro-3-(1H-indol-3-ylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Brevianamide F
CAS:Brevianamide FFormula:C16H17N3O2Purity:≥95%Color and Shape:SolidMolecular weight:283.33L-Prolyl-L-tryptophan anhydride
CAS:Formula:C16H17N3O2Purity:98%Color and Shape:SolidMolecular weight:283.3251(3S,8As)-3-((1H-Indol-3-Yl)Methyl)Hexahydropyrrolo[1,2-A]Pyrazine-1,4-Dione
CAS:(3S,8As)-3-((1H-Indol-3-Yl)Methyl)Hexahydropyrrolo[1,2-A]Pyrazine-1,4-DioneFormula:C16H17N3O2Purity:98%Molecular weight:283.33Brevianamide F
CAS:Brevianamide F (Cyclo(L-Pro-L-Trp)), also known as cyclo-(L-Trp-L-Pro), belongs to a class of naturally occurring 2,5-diketopiperazines.Formula:C16H17N3O2Purity:97.30% - 98.82%Color and Shape:SolidMolecular weight:283.33Brevianamide F
CAS:(3S,8aS)-3-((1H-Indol-3-yl)methyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dioneFormula:C16H17N3O2Purity:98%Molecular weight:283.33Brevianamide F
CAS:Applications Brevianamide F is used in the preparation, reactions, medicinal and cheical propreties of diketopiperazines as bioactive natural products. Acts as a reagent in the total synthesis and antitumor activity in vitro of glioperazine C and its derivatives, synthesis and biological evaluation of a post-synthetically trp-based diketopiperazine and it’s antitumor structure-activity relationship.
References Wang, P., et al.: J. Chem. Pharma. Res., 7, 85 (2015); Preciado, S., et al.: MedChemComm, 4, 1171 (2013); Borthwick, A. D., et al.: Chem. Rev., 112, 3641 (2012)Formula:C16H17N3O2Color and Shape:NeatMolecular weight:283.33Brevianamide F
CAS:Brevianamide F is an alkaloid compound, which is a secondary metabolite derived from certain fungal species, particularly from the genus *Penicillium*. This natural product is biosynthesized via complex enzymatic pathways within the fungi. The mode of action of Brevianamide F involves interaction with biological macromolecules, potentially disrupting or modulating various cellular processes. Research suggests it may possess biological activities such as antimicrobial, antifungal, and potentially cytotoxic properties.Formula:C16H17N3O2Purity:Min. 95%Molecular weight:283.33 g/mol







