CAS 38136-75-3
:L-Tryptophyl-L-proline
Description:
L-Tryptophyl-L-proline, with the CAS number 38136-75-3, is a dipeptide composed of the amino acids L-tryptophan and L-proline. This compound exhibits characteristics typical of peptides, including the ability to participate in various biochemical reactions due to its functional groups. L-Tryptophyl-L-proline is known for its potential role in biological processes, particularly in protein synthesis and as a precursor for neurotransmitters. The presence of tryptophan, an essential amino acid, contributes to its significance in the synthesis of serotonin, a neurotransmitter involved in mood regulation. Proline, on the other hand, is known for its role in stabilizing protein structures. This dipeptide may exhibit solubility in polar solvents, and its stability can be influenced by pH and temperature. Additionally, it may have implications in pharmacology and nutrition, although specific biological activities and therapeutic applications require further investigation. Overall, L-Tryptophyl-L-proline represents an interesting subject for research in biochemistry and molecular biology.
Formula:C16H19N3O3
InChI:InChI=1S/C16H19N3O3/c17-12(15(20)19-7-3-6-14(19)16(21)22)8-10-9-18-13-5-2-1-4-11(10)13/h1-2,4-5,9,12,14,18H,3,6-8,17H2,(H,21,22)/t12-,14-/m0/s1
InChI key:InChIKey=DXYQIGZZWYBXSD-JSGCOSHPSA-N
SMILES:C([C@@H](C(=O)N1[C@H](C(O)=O)CCC1)N)C=2C=3C(NC2)=CC=CC3
Synonyms:- 163: PN: US20130123467 SEQID: 198 claimed protein
- 32: PN: WO03052099 PAGE: 84 claimed protein
- <span class="text-smallcaps">L</smallcap>-Proline, 1-<smallcap>L</span>-tryptophyl-
- <span class="text-smallcaps">L</smallcap>-Proline, <smallcap>L</span>-tryptophyl-
- <span class="text-smallcaps">L</smallcap>-Tryptophyl-<smallcap>L</span>-proline
- H-Trp-Pro-OH
- L-Proline,1-L-tryptophyl-
- Trp-Pro
- L-Tryptophyl-L-proline
- L-Proline, L-tryptophyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Trp-Pro-OH
CAS:Bachem ID: 4003908.
Formula:C16H19N3O3Purity:> 99%Color and Shape:White PowderMolecular weight:301.35H-Trp-Pro-OH
CAS:H-Trp-Pro-OH is an amide that can be used as a model system in the preparation of collagen. It has been shown to inhibit the linker between collagen molecules, which may lead to the formation of proline-rich peptides. H-Trp-Pro-OH has also been found to have anticancer properties, and inhibits cancer cell growth by inhibiting protein synthesis and promoting apoptosis. H-Trp-Pro-OH was found to inhibit cancer cells through a mechanism that is not yet fully understood, but it may involve both competitive inhibition of amino acids and activation of apoptosis through reactive oxygen species.Formula:C16H19N3O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:301.34 g/mol

