CAS 3814-20-8
:6-chloro-N,N-dimethylpyridazin-3-amine
Description:
6-Chloro-N,N-dimethylpyridazin-3-amine is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a chlorine atom at the 6-position and two dimethylamino groups at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit basic properties due to the presence of the amine functional group, making it capable of forming salts with acids. The compound is of interest in medicinal chemistry and may have applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.
Formula:C6H8ClN3
InChI:InChI=1/C6H8ClN3/c1-10(2)6-4-3-5(7)8-9-6/h3-4H,1-2H3
SMILES:CN(C)c1ccc(Cl)nn1
Synonyms:- 3-Pyridazinamine, 6-chloro-N,N-dimethyl-
- 6-Chloro-N,N-dimethylpyridazin-3-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(4-Sulfanylphenyl)ethan-1-one
CAS:The thiourea is a chemical compound that contains both nitrogen and sulfur. It can be prepared by oxidation of the sulfide with nitrous acid, or by reaction of ammonia with sulfur dioxide. The optical activity of the thiourea has been studied through simulations with quantum mechanics methods. The anion radical was found to be the driving force for the reaction mechanism. Cyclic voltammetry was used to investigate the kinetics and to detect chloride as an interfering species. Chloride-induced adsorption equilibrium was found in experiments where chloride is present at high concentrations. Rofecoxib, an NSAID drug, was found to adsorb onto aluminium surfaces under certain conditions, which can lead to environmental pollution.Formula:C8H8OSPurity:Min. 95%Molecular weight:152.22 g/mol


