CAS 3815-20-1
:4-Biphenylcarboxamide
Description:
4-Biphenylcarboxamide, also known by its IUPAC name, is an organic compound characterized by the presence of a biphenyl group attached to a carboxamide functional group. This compound typically appears as a white to off-white solid and is known for its relatively high melting point. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of the carboxamide group contributes to its ability to engage in hydrogen bonding, which can influence its physical properties and reactivity. 4-Biphenylcarboxamide is often studied for its potential applications in pharmaceuticals and materials science, particularly due to its structural features that may impart specific biological or chemical activities. Additionally, it may serve as a building block in organic synthesis, allowing for the development of more complex molecules. Safety data should be consulted when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C13H11NO
InChI:InChI=1/C13H11NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,14,15)
SMILES:c1ccc(cc1)c1ccc(cc1)C(=O)N
Synonyms:- 4-Phenylbenzamide
- Biphenyl-4-Carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[1,1'-Biphenyl]-4-carboxamide
CAS:Formula:C13H11NOPurity:98%Color and Shape:SolidMolecular weight:197.2325Biphenyl-4-carboxamide
CAS:Biphenyl-4-carboxamideFormula:C13H11NOPurity:97%Color and Shape: faint beige powderMolecular weight:197.23g/mol4-Phenylbenzamide
CAS:4-Phenylbenzamide is a dimethylformamide (DMF) analog that has been shown to be a potent inhibitor of p38 kinase. It has been studied in vitro and in vivo for its effects on the liver, where it was found to act as a dehydrating agent and increase the rate of reaction. DMF showed no toxicity at concentrations up to 10 mM in human liver cells. 4-Phenylbenzamide has also been shown to have analgesic properties by acting as an agonist at the neuropathic receptors. This drug is orally bioavailable and can be taken by humans with no adverse side effects.
Formula:C13H11NOPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:197.23 g/mol



